ABEIXI™
标准品
| M8PFOA | 1350614-84-4 | Perfluoro-n-[13C8]octanoic acid |
| MPFNA | 960315-49-5 | Perfluoro-n-[1,2,3,4,5-13C5]nonanoic acid |
| M9PFNA | 2283397-80-6 | Perfluoro-n-[13C9]nonanoic acid |
| MPFDA | 960315-50-8 | Perfluoro-n-[1,2-13C2]decanoic acid |
| M6PFDA | 2328024-56-0 | Perfluoro-n-[1,2,3,4,5,6-13C6]decanoic acid |
| MPFUdA | 960315-51-9 | Perfluoro-n-[1,2-13C2]undecanoic acid |
| M7PFUdA | - | Perfluoro-n-[1,2,3,4,5,6,7-13C7]undecanoic acid |
| MPFDoA | 960315-52-0 | Perfluoro-n-[1,2-13C2]dodecanoic acid |
| M2PFTeDA | - | Perfluoro-n-[1,2-13C2]tetradecanoic acid |
| M2PFHxDA | - | Perfluoro-n-[1,2-13C2]hexadecanoic acid |
| PFC-MXA | - | Native PFCA Solution/Mixture |
| PFS-MXA | - | Native PFAS Solution/Mixture |
| PFAC-MXA | - | Native PFCAs and PFASs Solution/Mixture |
| PFAC-MXB | - | Native PFCAs and PFASs Solution/Mixture |
| PFAC-24PAR | - | Native PFAS Precision and Recovery Standard Solution (containing brPFHxS & brPFOS) |
| MPFAC-MXA | - | Mass-Labelled PFCAs and PFASs Solution/Mixture |
| EPA-537SS-R1 | - | U.S. EPA Method 537 Surrogate Primary Dilution Standard (SUR PDS) |
| EPA-537IS | - | U.S. EPA Method 537 Internal Standard Primary Dilution Standard (IS PDS) |
| MPFAC-24ES | - | Mass-Labelled PFAS Extraction Standard Solution |
| P1MHpS | - | Perfluoro-1-methylheptane sulfonate |
| P3MHpS | - | Perfluoro-3-methylheptane sulfonate; |
| Perfluoro-3-methylheptanoic acid | ||
| P4MHpS | - | Perfluoro-4-methylheptane sulfonate; |
| Perfluoro-4-methylheptanoic acid | ||
| P5MHpS | - | Perfluoro-5-methylheptane sulfonate; |
| Perfluoro-5-methylheptanoic acid | ||
| P6MHpS | - | Perfluoro-6-methylheptane sulfonate; |
| Perfluoro-6-methylheptanoic acid | ||
| P55DMHxS | - | Perfluoro-5,5-dimethylhexane sulfonate; |
| Perfluoro-5,5-dimethylhexanoic acid | ||
| P45DMHxS | - | Perfluoro-4,5-dimethylhexane sulfonate; |
| Perfluoro-4,5-dimethylhexanoic acid; | ||
| Perfluoro-3,5-dimethylhexane sulfonate; | ||
| Perfluoro-3,5-dimethylhexanoic acid | ||
| FOSA-I | 754-91-6 | Perfluoro-1-octanesulfonamide |
| N-MeFOSA-M | 31506-32-8 | N-methylperfluoro-1-octansulfonamide |
| N,N-Me2FOSA-M | 213181-78-3 | N,N-dimethylperfluoro-1-octanesulfonamide |
| N-EtFOSA-M | 4151-50-2 | N-ethylperfluoro-1-octanesulfonamide |
| M8FOSA-I | - | Perfluoro-1-[13C8]octanesulfonamide |
| d-N-MeFOSA-M | 936109-37-4 | N-methyl-d3-perfluoro-1-octanesulfonamide |
| d-N-EtFOSA-M | 936109-40-9 | N-ethyl-d5-perfluoro-1-octanesulfonamide |
| N-MeFOSE-M | 24448-09-7 | 2-(N-methylperfluoro-1-octanesulfonamido)-ethanol |
| N-EtFOSE-M | 1691-99-2 | 2-(N-ethylperfluoro-1-octanesulfonamido)-ethanol |
| d7-N-MeFOSE-M | 1265205-95-5 | 2-(N-methyl-d3-perfluoro-1-octanesulfonamido)ethan-d4-ol |
| d9-N-EtFOSE-M | 1265205-96-6 | 2-(N-ethyl-d5-perfluoro-1-octanesulfonamido)ethan-d4-ol |
| FOSAA | 2806-24-8 | Perfluoro-1-octanesulfonamidoacetic acid |
| N-MeFOSAA | 2355-31-9 | N-methylperfluoro-1-octanesulfonamidoacetic acid |
| N-EtFOSAA | 2991-50-6 | N-ethylperfluoro-1-octanesulfonamidoacetic acid |
| d3-N-MeFOSAA | - | N-methyl-d3-perfluoro-1-octanesulfonamidoacetic acid |
| d5-N-EtFOSAA | 1265205-97-7 | N-ethyl-d5-perfluoro-1-octanesulfonamidoacetic acid |
| FBET | 2043-47-2 | 2-Perfluorobutyl ethanol(4:2) |
| 5:2sFTOH | 914637-05-1 | 1-Perfluoropentyl ethanol(5:2 secondary) |
| FHET | 647-42-7 | 2-Perfluorohexyl ethanol(6:2) |
| 7:2sFTOH | 24015-83-6 | 1-Perfluoroheptyl ethanol(7:2 secondary) |
| FOET | 678-39-7 | 2-Perfluorooctyl ethanol(8:2) |
| FDET | 865-86-1 | 2-Perfluorodecyl ethanol(10:2) |
| MFBET | - | 2-Perfluorobutyl-[1,1,2,2-2H4]-ethanol(4:2) |
| MFHET | 872398-72-6 | 2-Perfluorohexyl-[1,1-2H2]-[1,2-13C2]-ethanol(6:2) |
| M2FHET | - | 2-Perfluorohexyl-[1,2-13C2]-ethanol(6:2) |
| MFOET | 872398-73-7 | 2-Perfluorooctyl-[1,1-2H2]-[1,2-13C2]-ethanol(8:2) |
| M2FOET | - | 2-Perfluorooctyl-[1,2-13C2]-ethanol(8:2) |
| MFDET | 872398-74-8 | 2-Perfluorodecyl-[1,1-2H2]-[1,2-13C2]-ethanol(10:2) |
| FHEA | 53826-12-3 | 2-Perfluorohexyl ethanoic acid(6:2) |
| FOEA | 27854-31-5 | 2-Perfluorooctyl ethanoic acid(8:2) |
| FDEA | 53826-13-4 | 2-Perfluorodecyl ethanoic acid(10:2) |
| FPrPA | 356-02-5 | 3-Perfluoropropyl propanoic acid(3:3) |
| FPePA | 914637-49-3 | 3-Perfluoropentyl propanoic acid(5:3) |
| FHpPA | 812-70-4 | 3-Perfluoroheptyl propanoic acid(7:3) |
| FTA-MXA | - | Native FTA Solution/Mixture |
| MFHEA | 872398-75-9 | 2-Perfluorohexyl-[1,2-13C2]-ethanoic acid(6:2) |
| MFOEA | 872398-76-0 | 2-Perfluorooctyl-[1,2-13C2]-ethanoic acid(8:2) |
| MFDEA | 872398-77-1 | 2-Perfluorodecyl-[1,2-13C2]-ethanoic acid(10:2) |
| MFTA-MXA | - | Mass-Labelled FTA Solution/Mixture |
| FHUEA | 70887-88-6 | 2H-Perfluoro-2-octenoic acid(6:2) |
| FOUEA | 70887-84-2 | 2H-Perfluoro-2-decenoic acid(8:2) |
| FDUEA | 70887-94-4 | 2H-Perfluoro-2-dodecenoic acid(10:2) |
| MFHUEA | 872398-78-2 | 2H-Perfluoro-2-[1,2-13C2]-octenoic acid(6:2) |
| MFOUEA | 872398-79-3 | 2H-Perfluoro-2-[1,2-13C2]-decenoic acid(8:2) |
| MFDUEA | 872398-80-6 | 2H-Perfluoro-2-[1,2-13C2]-dodecenoic acid(10:2) |
| 9Cl-PF3ONS | 73606-19-6 (F-53B) | Potassium 9-chlorohexadecafluoro-3-oxanonane-1-sulfonate |
| 11Cl-PF3OUdS | 83329-89-9 | Potassium 11-chloroeicosafluoro-3-oxaundecane-1-sulfonate |
| (minor component of F-53B) | ||
| NaDONA | 2250081-67-3 | Sodium dodecafluoro-3H-4,8-dioxanonanoate (ADONA CAS 958445-44-8 ) |
| HFPO-DA | 13252-13-6 | 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid (GenX) |
| M3HFPO-DA | - | 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-13C3-propanoic acid (13C-GenX) |
| 4:2FTS | 27619-93-8 | Sodium 1H,1H,2H,2H-perfluorohexane sulfonate(4:2) |
| 6:2FTS | 27619-94-9 | Sodium 1H,1H,2H,2H-perfluorooctane sulfonate(6:2) |
| 8:2FTS | 27619-96-1 | Sodium 1H,1H,2H,2H-perfluorodecane sulfonate(8:2) |
| 10:2FTS | 108026-35-3 | Sodium 1H,1H,2H,2H-perfluorododecane sulfonate(10:2) |
| M2-4:2FTS | 2708218-88-4 | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-hexane sulfonate(4:2) |
| M2-6:2FTS | 2708218-89-5 | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-octane sulfonate(6:2) |
| M2-8:2FTS | 2708218-90-8 | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-decane sulfonate(8:2) |
| 8:2FTOAc | 37858-04-1 | 1H,1H,2H,2H-Perfluorodecyl acetate |
| 10:2FTOAc | 37858-05-2 | 1H,1H,2H,2H-Perfluorododecyl acetate |
| 8:2FTAcr | 27905-45-9 | 1H,1H,2H,2H-Perfluorodecyl acrylate |
| 10:2FTAcr | 17741-60-5 | 1H,1H,2H,2H-Perfluorododecyl acrylate (>95%) |
| PFHxPA | 40143-76-8 | Perfluorohexylphosphonic acid |
| PFOPA | 40143-78-0 | Perfluorooctylphosphonic acid |
| PFDPA | 52299-26-0 | Perfluorodecylphosphonic acid |
| Cl-PFHxPA | - | 6-Chloroperfluorohexylphosphonic acid |
| Cl-PFOPA | - | 8-Chloroperfluorooctylphosphonic acid |
| 6:6PFPi | 70609-44-8 | Sodium bis(perfluorohexyl)phosphinate |
| 6:8PFPi | 2361298-14-6 | Sodium perfluorohexylperfluorooctylphosphinate |
| 8:8PFPi | 500776-69-2 | Sodium bis(perfluorooctyl)phosphinate |
| 6:2PAP | 150033-29-7 | Disodium 1H,1H,2H,2H-perfluorooctyl phosphate |
| 8:2PAP | 438237-75-3 | Disodium 1H,1H,2H,2H-perfluorodecyl phosphate |
| 6:2diPAP | 407582-79-0 | Sodium bis(1H,1H,2H,2H-perfluorooctyl) phosphate |
| 8:2diPAP | 114519-85-6 | Sodium bis(1H,1H,2H,2H-perfluorodecyl) phosphate |
| 6:2/8:2diPAP | - | Sodium (1H,1H,2H,2H-perfluorooctyl-1H,1H.2H,2H-perfluorodecyl) phosphate |
| SAmPAP | 2624-80-8 | Disodium 2-(N-ethylperfluorooctane-1-sulfonamido)ethyl phosphate |
| diSAmPAP | 23282-60-2 | Sodium bis-[2-(N-ethylperfluorooctane-1-sulfonamido)ethyl] phosphate |
| M2-6:2PAP | - | Disodium 1H,1H,2H,2H-[1,2-13C2]perfluorooctyl phosphate |
| M2-8:2PAP | - | Disodium 1H,1H,2H,2H-[1,2-13C2]perfluorodecyl phosphate |
| M4-6:2diPAP | - | Sodium bis(1H,1H,2H,2H-[1,2-13C2]perfluorooctyl) phosphate |
| M4-8:2diPAP | - | Sodium bis(1H,1H,2H,2H-[1,2-13C2]perfluorodecyl) phosphate |
| PAH-CVS-B | - | PAH-CVS-B Calibration Kit |
| PAH-LCS-B | - | PAH Labelled Compound Solution |
| PAH-ISS-B | - | PAH Internal Standard Spiking Solution |
| PAH-SS-B | - | PAH Sampling Standard Solution |
| PAH-STK-B | - | PAH Native Stock Solution |
| L429-CVS | - | L429-CVS Calibration Kit |
| L429-SS | - | Method 429 Surrogate Standard Stock Solution |
| L429-IS | - | Method 429 Internal Standard Stock Solution |
| L429-AS | - | Method 429 Alternate Standard Stock Solution |
| L429-RS | - | Method 429 Recovery Standard Stock Solution |
| L429-PAR | - | Method 429 Native PAH Stock Solution |
| EPA-PAH-STK | - | Native PAH Solution/Mixture |
| EPA-PAH-LCS | - | Deuterated PAH Solution/Mixture |
| EPA-EU-PAH-ISS | - | Deuterated PAH Solution/Mixture |
| EU-PAH-STK | - | Native PAH Solution/Mixture |
| EU-PAH-LCS | - | Deuterated PAH Solution/Mixture |
| 4H107 | 152969-11-4 | 2,3,3′,4′,5-Pentachloro-4-biphenylol |
| 4H108 | 149589-55-9 | 2′,3,3′,4′,5-Pentachloro-4-biphenylol (>96%) |
| 3H118 | 170946-11-9 | 2,3′,4,4′,5-Pentachloro-3-biphenylol |
| 4H130 | 158076-62-1 | 2,2′,3,3′,4′,5-Hexachloro-4-biphenylol |
| 3H138 | - | 2,2′,3′,4,4′,5-Hexachloro-3-biphenylol |
| 4H146 | 145413-90-7 | 2,2′,3,4′,5,5′-Hexachloro-4-biphenylol |
| 3H153 | 54284-55-8 | 2,2′,4,4′,5,5′-Hexachloro-3-biphenylol |
| 4H172 | 158076-64-3 | 2,2′,3,3′,4′,5,5′-Heptachloro-4-biphenylol |
| 3H180 | 158076-69-8 | 2,2′,3′,4,4′,5,5′-Heptachloro-3-biphenylol |
| 4H187 | 158076-68-7 | 2,2′,3,4′,5,5′,6-Heptachloro-4-biphenylol |
| M4H12 | - | 3′,4′-Dichloro-4-[13C12]biphenylol |
| M4H29 | - | 2′,4′,5′-Trichloro-4-[13C12]biphenylol |
| M4H61 | - | 2′,3′,4′,5′-Tetrachloro-4-[13C12]biphenylol |
| M4H120 | - | 2′,3,4′,5,5′-Pentachloro-4-[13C12]biphenylol |
| M4H159 | - | 2′,3,3′,4′,5,5′-Hexachloro-4-[13C12]biphenylol |
| M4H172 | - | 2,2′,3,3′,4′,5,5′-Heptachloro-4-[13C12]biphenylol |
| M4H187 | - | 2,2′,3,4′,5,5′,6-Heptachloro-4-[13C12]biphenylol |
| MHPCB-MXA | - | Mass-Labelled Chlorinated Biphenylol Solution/Mixture |
| 4PM79 | - | 3,3′,4′,5-Tetrachloro-4-methoxybiphenyl |
| 4PM97 | - | 2,2′,3,4′,5′-Pentachloro-4-methoxybiphenyl |
| 4PM101 | - | 2,2′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
| 4M107 | - | 2,3,3′,4′,5-Pentachloro-4-methoxybiphenyl |
| 4PM108 | - | 2,3,3′,4,5′-Pentachloro-4′-methoxybiphenyl |
| 3M118 | - | 2,3′,4,4′,5-Pentachloro-3-methoxybiphenyl |
| 4PM120 | - | 2,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
| 4PM127 | - | 3,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
| 4PM130 | - | 2,2′,3,3′,4′,5-Hexachloro-4-methoxybiphenyl |
| 4M134 | - | 2,2′,3,3′,5,6-Hexachloro-4-methoxybiphenyl |
| 3PM138 | - | 2,2′,3′,4,4′,5-Hexachloro-3-methoxybiphenyl |
| 4M146 | - | 2,2′,3,4′,5,5′-Hexachloro-4-methoxybiphenyl |
| 33PDM155 | - | 2,2′,4,4′,6,6′-Hexachloro-3,3′-dimethoxybiphenyl |
| 4PM159 | - | 2,3,3′,4,5,5′-Hexachloro-4′-methoxybiphenyl |
| 4M162 | - | 2,3,3′,4′,5,5′-Hexachloro-4-methoxybiphenyl |
| 4M163 | - | 2,3,3′,4′,5,6-Hexachloro-4-methoxybiphenyl |
| 4PM172 | - | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxybiphenyl |
| 4M177 | - | 2,2′,3,3′,4′,5,6-Heptachloro-4-methoxybiphenyl |
| 4M178 | - | 2,2′,3,3′,5,5′,6-Heptachloro-4-methoxybiphenyl |
| 3PM180 | - | 2,2′,3,4,4′,5,5′-Heptachloro-3′-methoxybiphenyl |
| 3PM182 | - | 2,2′,3,4,4′,5,6′-Heptachloro-3′-methoxybiphenyl |
| 3PM183 | - | 2,2′,3′,4,4′,5,6′-Heptachloro-3-methoxybiphenyl |
| 3PM184 | - | 2,2′,3,4,4′,6,6′-Heptachloro-3′-methoxybiphenyl |
| 4M187 | - | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxybiphenyl |
| 4M193 | - | 2,3,3′,4′,5,5′,6-Heptachloro-4-methoxybiphenyl |
| 4PM198 | - | 2,2′,3,3′,4,5,5′,6-Octachloro-4′-methoxybiphenyl |
| 4PM199 | - | 2,2′,3,3′,4′,5,5′,6-Octachloro-4-methoxybiphenyl |
| 4PM200 | - | 2,2′,3,3′,4,5,6,6′-Octachloro-4′-methoxybiphenyl |
| 4PM201 | - | 2,2′,3,3′,4′,5,6,6′-Octachloro-4-methoxybiphenyl |
| 4M202 | - | 2,2′,3,3′,5,5′,6,6′-Octachloro-4-methoxybiphenyl |
| 44PDM202 | - | 2,2′,3,3′,5,5′,6,6′-Octachloro-4,4′-dimethoxybiphenyl |
| 3PM203 | - | 2,2′,3,4,4′,5,5′,6-Octachloro-3′-methoxybiphenyl |
| 4PM208 | - | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro-4′-methoxybiphenyl |
| MPCB-MXA | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXB | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXC | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXD | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXE | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXF | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXG | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXH | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXI | - | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| M4M29 | - | 2,4,5-Trichloro-4′-methoxy[13C12]biphenyl |
| M4M61 | - | 2,3,4,5-Tetrachloro-4′-methoxy[13C12]biphenyl |
| M4M120 | - | 2,3′,4,5,5′-Pentachloro-4′-methoxy[13C12]biphenyl |
| M4M159 | - | 2,3,3′,4,5,5′-Hexachloro-4′-methoxy[13C12]biphenyl |
| M4M172 | - | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxy[13C12]biphenyl |
| M4M187 | - | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxy[13C12]biphenyl |
| MMPCB-MXA | - | Mass-Labelled Chlorinated Methoxybiphenyl Solution/Mixture |
| CBP-2 | 50558-21-9 | 2-Chlorobiphenylene |
| CBP-23 | 909024-10-8 | 2,3-Dichlorobiphenylene |